CymitQuimica logo

CAS 885271-11-4

:

Ethyl 5-nitropyrazolo[1,5-a]pyridine-3-carboxylate

Description:
Ethyl 5-nitropyrazolo[1,5-a]pyridine-3-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrazolo-pyridine framework. This compound features a nitro group at the 5-position of the pyrazole ring, contributing to its reactivity and potential applications in various chemical reactions. The ethyl ester functional group at the carboxylate position enhances its solubility in organic solvents, making it suitable for synthetic applications. The presence of the nitro group also suggests potential for further functionalization, which can be exploited in medicinal chemistry for developing bioactive compounds. Additionally, the compound may exhibit interesting biological activities due to its heterocyclic nature, which is often associated with pharmacological properties. Its molecular structure allows for various interactions, making it a candidate for research in drug development and material science. As with many nitro-containing compounds, care should be taken regarding its handling and storage due to potential sensitivity to heat and shock.
Formula:C10H9N3O4
InChI:InChI=1S/C10H9N3O4/c1-2-17-10(14)8-6-11-12-4-3-7(13(15)16)5-9(8)12/h3-6H,2H2,1H3
InChI key:InChIKey=KJZWPZDSRYGTRT-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2N(N=C1)C=CC(N(=O)=O)=C2
Synonyms:
  • 5-Nitro-Pyrazolo[1,5-A]Pyridine-3-Carboxylic Acid Ethyl Ester
  • Ethyl 5-nitropyrazolo[1,5-a]pyridine-3-carboxylate
  • Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 5-nitro-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.