CAS 885271-14-7
:3-(3-Methoxyphenyl)-1H-indazole
Description:
3-(3-Methoxyphenyl)-1H-indazole is an organic compound characterized by its indazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a methoxyphenyl group at the 3-position of the indazole structure contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. It may also display interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. The methoxy group can influence the compound's electronic properties and reactivity, potentially affecting its interactions with biological targets. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, such as electrophilic substitutions or coupling reactions, which are common in organic synthesis. Overall, 3-(3-Methoxyphenyl)-1H-indazole is a versatile compound with potential applications in research and pharmaceuticals.
Formula:C14H12N2O
InChI:InChI=1S/C14H12N2O/c1-17-11-6-4-5-10(9-11)14-12-7-2-3-8-13(12)15-16-14/h2-9H,1H3,(H,15,16)
InChI key:InChIKey=FSCZEHGQJFAYSP-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=2C=3C(NN2)=CC=CC3)C=CC1
Synonyms:- 3-(3-Methoxy-Phenyl)-1H-Indazole
- 3-(3-Methoxyphenyl)-1H-indazole
- 1H-Indazole, 3-(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
