CAS 885271-15-8
:6-Bromo-8-methoxy-2H-1-benzopyran-3-carboxaldehyde
Description:
6-Bromo-8-methoxy-2H-1-benzopyran-3-carboxaldehyde is an organic compound characterized by its unique structural features, which include a benzopyran core, a bromine substituent, and a methoxy group. The presence of the aldehyde functional group at the 3-position contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and oxidation. The bromine atom enhances the compound's electrophilicity, while the methoxy group can influence its solubility and polarity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could lead to pharmacological applications. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for its identification and characterization in laboratory settings. Overall, 6-Bromo-8-methoxy-2H-1-benzopyran-3-carboxaldehyde represents a versatile structure in organic synthesis and medicinal chemistry.
Formula:C11H9BrO3
InChI:InChI=1S/C11H9BrO3/c1-14-10-4-9(12)3-8-2-7(5-13)6-15-11(8)10/h2-5H,6H2,1H3
InChI key:InChIKey=PONWUBMQESLCLP-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C=C(C=O)CO2)=CC(Br)=C1
Synonyms:- 6-Bromo-8-Methoxy-2H-Chromene-3-Carbaldehyde
- 6-Bromo-8-methoxy-2H-1-benzopyran-3-carboxaldehyde
- 2H-1-Benzopyran-3-carboxaldehyde, 6-bromo-8-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
