CymitQuimica logo

CAS 885271-16-9

:

6-Bromo-3-phenyl-1H-indazole

Description:
6-Bromo-3-phenyl-1H-indazole is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 6-position and a phenyl group at the 3-position contributes to its unique properties. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It may exhibit properties such as anti-inflammatory, anti-cancer, or neuroprotective effects, although specific biological activities can vary based on structural modifications and the presence of substituents. The compound is soluble in organic solvents, and its reactivity can be influenced by the bromine atom, which can participate in further chemical reactions. As with many indazole derivatives, it is important to handle this compound with care, following appropriate safety protocols, due to potential toxicity and reactivity.
Formula:C13H9BrN2
InChI:InChI=1S/C13H9BrN2/c14-10-6-7-11-12(8-10)15-16-13(11)9-4-2-1-3-5-9/h1-8H,(H,15,16)
InChI key:InChIKey=NBDDKVVSMSJOSD-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(C(=NN2)C3=CC=CC=C3)=CC1
Synonyms:
  • 6-Bromo-3-Phenyl-1H-Indazole
  • 1H-Indazole, 6-bromo-3-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.