CAS 885271-24-9
:6-Bromo-8-methoxy-2H-1-benzopyran-3-carbonitrile
Description:
6-Bromo-8-methoxy-2H-1-benzopyran-3-carbonitrile is a chemical compound characterized by its unique structural features, which include a benzopyran core, a bromine atom, a methoxy group, and a carbonitrile functional group. The presence of the bromine atom at the 6-position and the methoxy group at the 8-position contributes to its reactivity and potential biological activity. The carbonitrile group at the 3-position enhances its polarity and can influence its solubility in various solvents. This compound is of interest in medicinal chemistry and organic synthesis due to its potential applications in drug development and as a building block for more complex molecules. Its molecular structure suggests that it may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Additionally, the compound's stability, reactivity, and interactions with other chemical entities are influenced by its functional groups, making it a subject of interest in various fields of research, including organic chemistry and pharmacology.
Formula:C11H8BrNO2
InChI:InChI=1S/C11H8BrNO2/c1-14-10-4-9(12)3-8-2-7(5-13)6-15-11(8)10/h2-4H,6H2,1H3
InChI key:InChIKey=DEZLOCCCPMXTEQ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C=C(C#N)CO2)=CC(Br)=C1
Synonyms:- 6-Bromo-8-Methoxy-2H-Chromene-3-Carbonitrile
- 6-Bromo-8-methoxy-2H-1-benzopyran-3-carbonitrile
- 2H-1-Benzopyran-3-carbonitrile, 6-bromo-8-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
