CAS 885271-28-3
:5-benzyloxy-1H-indazole-3-carbaldehyde
Description:
5-Benzyloxy-1H-indazole-3-carbaldehyde is an organic compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a benzyloxy group at the 5-position enhances its solubility and reactivity, while the aldehyde functional group at the 3-position provides sites for further chemical modifications. This compound is typically used in organic synthesis and medicinal chemistry due to its potential biological activity. It may exhibit properties such as fluorescence or reactivity with nucleophiles, making it useful in various applications, including as a building block for more complex molecules. The compound's structure allows for diverse interactions, which can be exploited in drug design and development. Additionally, its stability and reactivity can be influenced by the substituents on the indazole ring, making it a versatile compound in research settings. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C15H12N2O2
InChI:InChI=1/C15H12N2O2/c18-9-15-13-8-12(6-7-14(13)16-17-15)19-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,16,17)
InChI key:InChIKey=LSVWVZRXSDJJFU-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NN1)=CC=C(OCC3=CC=CC=C3)C2
Synonyms:- 1H-indazole-3-carboxaldehyde, 5-(phenylmethoxy)-
- 5-(Phenylmethoxy)-1H-indazole-3-carboxaldehyde
- 5-Benzyloxy-1H-indazole-3-carboxaldehyde
- 5-(Benzyloxy)-1H-indazole-3-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
