CymitQuimica logo

CAS 885271-32-9

:

6,8-Dibromo-2H-1-benzopyran-3-carbonitrile

Description:
6,8-Dibromo-2H-1-benzopyran-3-carbonitrile is a chemical compound characterized by its unique structure, which includes a benzopyran moiety substituted with bromine and a cyano group. The presence of bromine atoms at the 6 and 8 positions contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The cyano group at the 3 position enhances its electronic properties, making it a useful intermediate in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential biological activity, which could be explored in pharmaceutical research. Additionally, the compound's stability and reactivity can be influenced by the presence of the bromine and cyano groups, making it a subject of interest for further studies in synthetic organic chemistry and material science. As with many brominated compounds, safety precautions should be taken due to potential toxicity and environmental concerns associated with brominated organic compounds.
Formula:C10H5Br2NO
InChI:InChI=1S/C10H5Br2NO/c11-8-2-7-1-6(4-13)5-14-10(7)9(12)3-8/h1-3H,5H2
InChI key:InChIKey=UNBJABPYHGUFEQ-UHFFFAOYSA-N
SMILES:BrC1=C2C(C=C(C#N)CO2)=CC(Br)=C1
Synonyms:
  • 6,8-Dibromo-2H-1-benzopyran-3-carbonitrile
  • 2H-1-Benzopyran-3-carbonitrile, 6,8-dibromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.