CAS 885271-36-3
:Ethyl 6-chloro-3,4-dihydro-2H-1-benzopyran-3-carboxylate
Description:
Ethyl 6-chloro-3,4-dihydro-2H-1-benzopyran-3-carboxylate is an organic compound characterized by its benzopyran structure, which features a fused benzene and pyran ring. This compound contains a chloro substituent at the 6-position and an ethyl ester functional group at the carboxylic acid position. The presence of the chloro group introduces unique reactivity and potential for further chemical modifications. Ethyl 6-chloro-3,4-dihydro-2H-1-benzopyran-3-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications, including medicinal chemistry and synthesis of other organic compounds. The compound may exhibit biological activity, making it of interest in pharmaceutical research. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C12H13ClO3
InChI:InChI=1S/C12H13ClO3/c1-2-15-12(14)9-5-8-6-10(13)3-4-11(8)16-7-9/h3-4,6,9H,2,5,7H2,1H3
InChI key:InChIKey=JVNIZDSHIPLLAH-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1CC=2C(OC1)=CC=C(Cl)C2
Synonyms:- 2H-1-Benzopyran-3-carboxylic acid, 6-chloro-3,4-dihydro-, ethyl ester
- Ethyl 6-chloro-3,4-dihydro-2H-1-benzopyran-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.