CAS 885271-39-6
:6-(Phenylmethoxy)-1H-indazole-3-carboxaldehyde
Description:
6-(Phenylmethoxy)-1H-indazole-3-carboxaldehyde is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a phenylmethoxy group, which contributes to its aromatic properties and enhances its potential for various chemical interactions. The presence of a carboxaldehyde functional group indicates that it can participate in reactions typical of aldehydes, such as nucleophilic addition and condensation reactions. The molecular structure suggests that it may exhibit interesting biological activities, making it a candidate for research in medicinal chemistry. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 6-(Phenylmethoxy)-1H-indazole-3-carboxaldehyde is a versatile compound with potential implications in various fields, including pharmaceuticals and organic synthesis.
Formula:C15H12N2O2
InChI:InChI=1S/C15H12N2O2/c18-9-15-13-7-6-12(8-14(13)16-17-15)19-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,16,17)
InChI key:InChIKey=LFUOXXIRMKMJLH-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(=CC(OCC3=CC=CC=C3)=CC2)NN1
Synonyms:- 6-(Phenylmethoxy)-1H-indazole-3-carboxaldehyde
- 6-Benzyloxy-1H-indazole-3-carboxaldehyde
- 1H-Indazole-3-carboxaldehyde, 6-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
