CAS 885271-65-8
:Methyl 3,4-dihydro-8-methoxy-2H-1-benzopyran-3-carboxylate
Description:
Methyl 3,4-dihydro-8-methoxy-2H-1-benzopyran-3-carboxylate, identified by its CAS number 885271-65-8, is a synthetic organic compound belonging to the class of benzopyrans, which are characterized by their fused benzene and pyran rings. This compound features a methoxy group and a carboxylate ester functional group, contributing to its chemical reactivity and potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the methoxy group enhances its lipophilicity, which may influence its solubility in organic solvents. Methyl 3,4-dihydro-8-methoxy-2H-1-benzopyran-3-carboxylate may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in fields such as agrochemicals, pharmaceuticals, and materials science. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C12H14O4
InChI:InChI=1S/C12H14O4/c1-14-10-5-3-4-8-6-9(12(13)15-2)7-16-11(8)10/h3-5,9H,6-7H2,1-2H3
InChI key:InChIKey=JBALJYNIRSHMLQ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(CC(C(OC)=O)CO2)=CC=C1
Synonyms:- 2H-1-Benzopyran-3-carboxylic acid, 3,4-dihydro-8-methoxy-, methyl ester
- 8-Methoxy-Chroman-3-Carboxylic Acid Methyl Ester
- Methyl 3,4-dihydro-8-methoxy-2H-1-benzopyran-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
