
CAS 885271-77-2
:Ethyl 3,4-dihydro-7-methoxy-2H-1-benzopyran-3-carboxylate
Description:
Ethyl 3,4-dihydro-7-methoxy-2H-1-benzopyran-3-carboxylate, with the CAS number 885271-77-2, is a chemical compound that belongs to the class of benzopyran derivatives. This compound features a benzopyran core, which is characterized by a fused benzene and pyran ring structure, contributing to its potential biological activity. The presence of the ethyl ester group at the carboxylate position enhances its solubility and reactivity. The methoxy group at the 7-position may influence its pharmacological properties, potentially affecting interactions with biological targets. This compound is of interest in medicinal chemistry due to its structural features, which may confer antioxidant, anti-inflammatory, or other therapeutic effects. Its synthesis and characterization typically involve standard organic chemistry techniques, and it may be evaluated for various applications in drug development or as a biochemical probe. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups.
Formula:C13H16O4
InChI:InChI=1S/C13H16O4/c1-3-16-13(14)10-6-9-4-5-11(15-2)7-12(9)17-8-10/h4-5,7,10H,3,6,8H2,1-2H3
InChI key:InChIKey=WYDXWFSEPMSSNJ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1CC=2C(=CC(OC)=CC2)OC1
Synonyms:- 2H-1-Benzopyran-3-carboxylic acid, 3,4-dihydro-7-methoxy-, ethyl ester
- Ethyl 3,4-dihydro-7-methoxy-2H-1-benzopyran-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
