CymitQuimica logo

CAS 885271-79-4

:

7-fluoro-3-oxo-3,4-dihydroquinoxaline-2-carboxylic acid

Description:
7-Fluoro-3-oxo-3,4-dihydroquinoxaline-2-carboxylic acid is a chemical compound characterized by its unique quinoxaline structure, which features a fused bicyclic system containing nitrogen atoms. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of a carboxylic acid group. The fluorine substituent at the 7-position can influence its reactivity and biological activity, potentially enhancing lipophilicity and altering interaction with biological targets. The keto group at the 3-position contributes to its reactivity, making it a candidate for various chemical transformations. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activities. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, 7-fluoro-3-oxo-3,4-dihydroquinoxaline-2-carboxylic acid represents a versatile scaffold for further chemical exploration and application in drug discovery.
Formula:C9H5FN2O3
InChI:InChI=1/C9H5FN2O3/c10-4-1-2-5-6(3-4)11-7(9(14)15)8(13)12-5/h1-3H,(H,12,13)(H,14,15)
SMILES:c1cc2c(cc1F)nc(c(=O)[nH]2)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.