CAS 885271-80-7
:3,4-Dihydro-7-methoxy-2H-1-benzopyran-3-methanamine
Description:
3,4-Dihydro-7-methoxy-2H-1-benzopyran-3-methanamine, with the CAS number 885271-80-7, is a chemical compound that belongs to the class of benzopyrans, which are characterized by a fused benzene and pyran ring structure. This compound features a methoxy group at the 7-position and an amine functional group, which can influence its reactivity and biological activity. The presence of the methoxy group typically enhances lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. The amine group may participate in hydrogen bonding and can act as a site for further chemical modifications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in areas related to neurochemistry or cardiovascular health. However, specific biological activities, toxicity, and therapeutic potential would require further investigation through experimental studies and clinical trials.
Formula:C11H15NO2
InChI:InChI=1S/C11H15NO2/c1-13-10-3-2-9-4-8(6-12)7-14-11(9)5-10/h2-3,5,8H,4,6-7,12H2,1H3
InChI key:InChIKey=XBWLPERHEWWKQN-UHFFFAOYSA-N
SMILES:C(N)C1CC=2C(=CC(OC)=CC2)OC1
Synonyms:- 3,4-Dihydro-7-methoxy-2H-1-benzopyran-3-methanamine
- 2H-1-Benzopyran-3-methanamine, 3,4-dihydro-7-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
