CymitQuimica logo

CAS 885271-83-0

:

4-(4-Fluorophenyl)-1,3-dihydro-5-(2-pyridinyl)-2H-imidazole-2-thione

Description:
4-(4-Fluorophenyl)-1,3-dihydro-5-(2-pyridinyl)-2H-imidazole-2-thione is a heterocyclic compound characterized by its imidazole core, which features a thione functional group. This compound contains a fluorophenyl substituent and a pyridinyl group, contributing to its potential biological activity and chemical reactivity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. The imidazole ring is known for its role in various biological systems, often acting as a pharmacophore in medicinal chemistry. The thione group introduces a sulfur atom, which can participate in coordination chemistry and may affect the compound's stability and reactivity. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its specific properties, such as solubility, melting point, and reactivity, would require empirical measurement or detailed computational studies for precise characterization.
Formula:C14H10FN3S
InChI:InChI=1S/C14H10FN3S/c15-10-6-4-9(5-7-10)12-13(18-14(19)17-12)11-3-1-2-8-16-11/h1-8H,(H2,17,18,19)
InChI key:InChIKey=GZYUADZOKFEJFZ-UHFFFAOYSA-N
SMILES:S=C1NC(=C(N1)C2=CC=CC=N2)C3=CC=C(F)C=C3
Synonyms:
  • 4-(4-Fluorophenyl)-1,3-dihydro-5-(2-pyridinyl)-2H-imidazole-2-thione
  • 5-(4-Fluoro-Phenyl)-4-Pyridin-2-Yl-1H-Imidazole-2-Thiol
  • 2H-Imidazole-2-thione, 4-(4-fluorophenyl)-1,3-dihydro-5-(2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.