CAS 885271-87-4

1-Cyclopentyl-3-ethyl-6-fluoro-1H-indazole

Description:

1-Cyclopentyl-3-ethyl-6-fluoro-1H-indazole is a synthetic organic compound characterized by its unique indazole structure, which consists of a five-membered ring fused to a six-membered aromatic ring. The presence of a cyclopentyl group and an ethyl group contributes to its hydrophobic characteristics, while the fluorine atom introduces electronegative properties that can influence its reactivity and biological activity. This compound is typically studied for its potential pharmacological applications, particularly in the fields of medicinal chemistry and drug development. Its molecular structure suggests that it may interact with various biological targets, making it of interest in the development of therapeutic agents. Additionally, the specific arrangement of substituents on the indazole core can affect its solubility, stability, and overall efficacy in biological systems. As with many synthetic compounds, understanding its characteristics, including its physical and chemical properties, is crucial for assessing its potential uses and safety in various applications.

Formula: C₁₄H₁₇FN₂

InChI: InChI=1S/C14H17FN2/c1-2-13-12-8-7-10(15)9-14(12)17(16-13)11-5-3-4-6-11/h7-9,11H,2-6H2,1H3

InChI key: InChIKey=NPPPAHGYJCCOSJ-UHFFFAOYSA-N

SMILES: C(C)C1=NN(C=2C1=CC=C(F)C2)C3CCCC3

Synonyms:

• 1-Cyclopentyl-3-Ethyl-6-Fluoro-1H-Indazole
• 1H-Indazole, 1-cyclopentyl-3-ethyl-6-fluoro-

1-Cyclopentyl-3-ethyl-6-fluoro-1H-indazole

Controlled Product

CAS: 885271-87-4

Please enquire for more information about 1-Cyclopentyl-3-ethyl-6-fluoro-1H-indazole including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₁₇FN₂

Purity: Min. 95%

Molecular weight: 232.3 g/mol

Ref: 3D-FC87375