CAS 885271-99-8
:1-Cyclobutyl-6-fluoro-3-methyl-1H-indazole
Description:
1-Cyclobutyl-6-fluoro-3-methyl-1H-indazole is a chemical compound characterized by its unique indazole structure, which consists of a five-membered ring fused to a six-membered aromatic ring. The presence of a cyclobutyl group and a fluorine atom at specific positions contributes to its distinct chemical properties. This compound typically exhibits moderate to high lipophilicity due to the hydrophobic cyclobutyl moiety, which can influence its solubility and bioavailability in various environments. The fluorine atom can enhance the compound's metabolic stability and may affect its interaction with biological targets. Additionally, the methyl group at the 3-position can influence the electronic properties and steric hindrance of the molecule. Overall, 1-Cyclobutyl-6-fluoro-3-methyl-1H-indazole is of interest in medicinal chemistry and drug development, particularly for its potential pharmacological activities, although specific biological data would be required to elucidate its therapeutic applications.
Formula:C12H13FN2
InChI:InChI=1S/C12H13FN2/c1-8-11-6-5-9(13)7-12(11)15(14-8)10-3-2-4-10/h5-7,10H,2-4H2,1H3
InChI key:InChIKey=DKBOBNSWLAGNCT-UHFFFAOYSA-N
SMILES:CC=1C=2C(N(N1)C3CCC3)=CC(F)=CC2
Synonyms:- 1-Cyclobutyl-6-Fluoro-3-Methyl-1H-Indazole
- 1H-Indazole, 1-cyclobutyl-6-fluoro-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-Cyclobutyl-6-fluoro-3-methyl-1H-indazole
CAS:1-Cyclobutyl-6-fluoro-3-methyl-1H-indazole
Molecular weight:204.24342g/mol


