
CAS 885272-06-0
:5-(Aminomethyl)-2,3-dihydro-1H-inden-1-ol
Description:
5-(Aminomethyl)-2,3-dihydro-1H-inden-1-ol, with the CAS number 885272-06-0, is an organic compound characterized by its unique bicyclic structure, which includes an indene framework. This compound features an amino group (-NH2) and a hydroxyl group (-OH) attached to the indene ring, contributing to its potential reactivity and solubility in polar solvents. The presence of the amino group suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest in synthetic organic chemistry. Additionally, the hydroxyl group can engage in hydrogen bonding, influencing its physical properties, such as boiling point and solubility. This compound may also exhibit biological activity, which could be relevant in pharmaceutical applications. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and literature review. Overall, 5-(Aminomethyl)-2,3-dihydro-1H-inden-1-ol represents a versatile structure with potential applications in various fields of chemistry and biology.
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c11-6-7-1-3-9-8(5-7)2-4-10(9)12/h1,3,5,10,12H,2,4,6,11H2
InChI key:InChIKey=MUUWCBRAVNOUBY-UHFFFAOYSA-N
SMILES:OC1C=2C(=CC(CN)=CC2)CC1
Synonyms:- 5-(Aminomethyl)-2,3-dihydro-1H-inden-1-ol
- 1H-Inden-1-ol, 5-(aminomethyl)-2,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.