CAS 885272-08-2
:Methyl 5-amino-1H-indazole-7-carboxylate
Description:
Methyl 5-amino-1H-indazole-7-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features an amino group at the 5-position and a carboxylate ester at the 7-position, contributing to its reactivity and potential biological activity. The methyl ester group enhances its solubility in organic solvents, making it useful in various synthetic applications. The presence of the amino group suggests potential for hydrogen bonding and interactions with biological targets, which may be relevant in medicinal chemistry. Methyl 5-amino-1H-indazole-7-carboxylate may exhibit properties such as moderate polarity and stability under standard conditions, but specific reactivity can depend on the surrounding environment and functional groups present. Its unique structure positions it as a candidate for further research in drug development, particularly in areas targeting specific enzymes or receptors. As with many indazole derivatives, it may also possess interesting pharmacological properties worth exploring.
Formula:C9H9N3O2
InChI:InChI=1/C9H9N3O2/c1-14-9(13)7-3-6(10)2-5-4-11-12-8(5)7/h2-4H,10H2,1H3,(H,11,12)
SMILES:COC(=O)c1cc(cc2cn[nH]c12)N
Synonyms:- 1H-indazole-7-carboxylic acid, 5-amino-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Amino-1H-indazole-7-carboxylic acid methyl ester
CAS:Formula:C9H9N3O2Color and Shape:SolidMolecular weight:191.1867Methyl 5-amino-1H-indazole-7-carboxylate
CAS:Formula:C9H9N3O2Purity:95.0%Color and Shape:Solid, No data available.Molecular weight:191.195-Amino-1H-indazole-7-carboxylic Acid Methyl Ester
CAS:Controlled Product<p>Applications 5-Amino-1H-indazole-7-carboxylic Acid Methyl Ester can be used in preparation of azabenzimidazoles as AMPA receptor modulators useful in treating diseases.<br>References Berry, C., et al.: PCT Int. Appl., WO 2016176460 A1 20161103 (2016)<br></p>Formula:C9H9N3O2Color and Shape:NeatMolecular weight:191.19


