CAS 885272-21-9
:Tetrahydro-4-(1H-indazol-6-yl)-2H-thiopyran-4-ol
Description:
Tetrahydro-4-(1H-indazol-6-yl)-2H-thiopyran-4-ol is a chemical compound characterized by its unique structural features, which include a thiopyran ring and an indazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of nitrogen and sulfur atoms in its structure. The thiopyran ring contributes to its stability and reactivity, while the indazole fragment may impart specific pharmacological properties. The compound is likely to be a solid at room temperature, with solubility varying depending on the solvent used, often showing better solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. As with many organic compounds, its behavior in reactions, stability under different conditions, and interactions with biological systems would be of interest for further research and development. Safety data and handling precautions should be considered when working with this compound, as with any chemical substance.
Formula:C12H14N2OS
InChI:InChI=1S/C12H14N2OS/c15-12(3-5-16-6-4-12)10-2-1-9-8-13-14-11(9)7-10/h1-2,7-8,15H,3-6H2,(H,13,14)
InChI key:InChIKey=IIXNPLQBOGAXCC-UHFFFAOYSA-N
SMILES:OC1(CCSCC1)C=2C=C3C(=CC2)C=NN3
Synonyms:- Tetrahydro-4-(1H-indazol-6-yl)-2H-thiopyran-4-ol
- 4-(1H-INDAZOL-6-YL)-TETRAHYDRO-THIOPYRAN-4-OL
- 2H-Thiopyran-4-ol, tetrahydro-4-(1H-indazol-6-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
