CAS 885272-28-6
:2,3-Dihydro-6-methoxy-2-oxo-1H-indole-3-acetic acid
Description:
2,3-Dihydro-6-methoxy-2-oxo-1H-indole-3-acetic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a methoxy group (-OCH3) and an acetic acid moiety, contributing to its potential biological activity. The presence of the keto group (C=O) at the 2-position and the indole framework suggests that it may exhibit various pharmacological properties, possibly including anti-inflammatory or analgesic effects. The compound's solubility and stability can be influenced by the functional groups present, making it relevant for medicinal chemistry and drug development. Its CAS number, 885272-28-6, allows for easy identification in chemical databases and literature. Overall, this compound represents a unique structure that may be of interest in the fields of organic synthesis and pharmaceutical research.
Formula:C11H11NO4
InChI:InChI=1S/C11H11NO4/c1-16-6-2-3-7-8(5-10(13)14)11(15)12-9(7)4-6/h2-4,8H,5H2,1H3,(H,12,15)(H,13,14)
InChI key:InChIKey=XLTFDSAWMWAHQS-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1C=2C(NC1=O)=CC(OC)=CC2
Synonyms:- 2,3-Dihydro-6-methoxy-2-oxo-1H-indole-3-acetic acid
- 2-(6-Methoxy-2-oxoindolin-3-yl)acetic acid
- 2-(6-Methoxy-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid
- 1H-Indole-3-acetic acid, 2,3-dihydro-6-methoxy-2-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(6-Methoxy-2-oxo-2,3-dihydro-1H-indol-3-yl)-acetic acid
CAS:Formula:C11H11NO4Molecular weight:221.2093
