CAS 885272-33-3
:6-(1-Methyl-4-piperidinyl)-1H-indazole
Description:
6-(1-Methyl-4-piperidinyl)-1H-indazole, identified by its CAS number 885272-33-3, is a chemical compound that belongs to the indazole class of compounds. It features a fused indazole ring system, which is a bicyclic structure containing both a five-membered and a six-membered ring. The presence of a 1-methyl-4-piperidinyl group contributes to its potential pharmacological properties, as piperidine derivatives are often associated with various biological activities. This compound may exhibit characteristics such as moderate to high solubility in organic solvents, depending on its specific functional groups and molecular interactions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychological conditions. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses and safety profile. As with many chemical substances, proper handling and safety precautions should be observed due to the potential for biological activity.
Formula:C13H17N3
InChI:InChI=1S/C13H17N3/c1-16-6-4-10(5-7-16)11-2-3-12-9-14-15-13(12)8-11/h2-3,8-10H,4-7H2,1H3,(H,14,15)
InChI key:InChIKey=DCOCFWGGMOZSDR-UHFFFAOYSA-N
SMILES:CN1CCC(C=2C=C3C(=CC2)C=NN3)CC1
Synonyms:- 6-(1-Methyl-4-piperidinyl)-1H-indazole
- 6-(1-Methyl-Piperidin-4-Yl)-1H-Indazole
- 1H-Indazole, 6-(1-methyl-4-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
