CAS 885272-50-4

2-(3-Methoxyphenyl)-4-thiazoleacetic acid

Description:

2-(3-Methoxyphenyl)-4-thiazoleacetic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications. The thiazole moiety contributes to its heterocyclic nature, which can influence its reactivity and interactions with biological systems. The presence of the methoxy group enhances its lipophilicity, potentially affecting its solubility and permeability in biological environments. Additionally, compounds like this may exhibit pharmacological activities, making them of interest in medicinal chemistry. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with altered properties. Overall, 2-(3-Methoxyphenyl)-4-thiazoleacetic acid represents a class of compounds that may have significant implications in drug development and other chemical applications, although specific biological activities and applications would require further investigation.

Formula: C₁₂H₁₁NO₃S

InChI: InChI=1S/C12H11NO3S/c1-16-10-4-2-3-8(5-10)12-13-9(7-17-12)6-11(14)15/h2-5,7H,6H2,1H3,(H,14,15)

InChI key: InChIKey=ONHLUKAWQAXVPL-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1N=C(SC1)C2=CC(OC)=CC=C2

Synonyms:

• 2-(3-Methoxyphenyl)-4-thiazoleacetic acid
• 4-Thiazoleacetic acid, 2-(3-methoxyphenyl)-