CymitQuimica logo

CAS 885272-57-1

:

Tetrahydro-4-(1H-indazol-5-yl)-2H-pyran-4-ol

Description:
Tetrahydro-4-(1H-indazol-5-yl)-2H-pyran-4-ol, with the CAS number 885272-57-1, is a chemical compound characterized by its unique bicyclic structure, which includes a tetrahydropyran ring fused with an indazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of nitrogen atoms in its structure. It may display solubility in polar solvents, and its reactivity can be influenced by the hydroxyl group (-OH) attached to the pyran ring, which can participate in hydrogen bonding and other interactions. The compound's molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where indazole derivatives are often explored for their therapeutic properties. Additionally, the presence of multiple functional groups may allow for further chemical modifications, enhancing its utility in various chemical syntheses and applications. As with any chemical substance, safety data and handling precautions should be consulted before use.
Formula:C12H14N2O2
InChI:InChI=1S/C12H14N2O2/c15-12(3-5-16-6-4-12)10-1-2-11-9(7-10)8-13-14-11/h1-2,7-8,15H,3-6H2,(H,13,14)
InChI key:InChIKey=NNIDNLBZDUCAFG-UHFFFAOYSA-N
SMILES:OC1(CCOCC1)C=2C=C3C(=CC2)NN=C3
Synonyms:
  • 4-(1H-Indazol-5-Yl)-Tetrahydro-Pyran-4-Ol
  • Tetrahydro-4-(1H-indazol-5-yl)-2H-pyran-4-ol
  • 2H-Pyran-4-ol, tetrahydro-4-(1H-indazol-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.