CAS 885272-59-3
:5-(Tetrahydro-2H-thiopyran-4-yl)-1H-indazole
Description:
5-(Tetrahydro-2H-thiopyran-4-yl)-1H-indazole, with the CAS number 885272-59-3, is a chemical compound characterized by its unique structural features, which include an indazole core fused with a tetrahydrothiopyran moiety. This compound typically exhibits properties associated with both heterocyclic compounds and sulfur-containing structures, which can influence its reactivity and biological activity. The presence of the indazole ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as indazoles are known for their diverse biological activities. The tetrahydrothiopyran group may contribute to the compound's lipophilicity and ability to interact with biological targets. Additionally, the compound's stereochemistry and functional groups can significantly affect its solubility, stability, and interaction with enzymes or receptors. Overall, 5-(Tetrahydro-2H-thiopyran-4-yl)-1H-indazole represents a class of compounds that may be of interest in drug discovery and development, particularly in areas related to neuropharmacology and anti-inflammatory research.
Formula:C12H14N2S
InChI:InChI=1S/C12H14N2S/c1-2-12-11(8-13-14-12)7-10(1)9-3-5-15-6-4-9/h1-2,7-9H,3-6H2,(H,13,14)
InChI key:InChIKey=CIASECHUXULVPN-UHFFFAOYSA-N
SMILES:C=1(C=C2C(=CC1)NN=C2)C3CCSCC3
Synonyms:- 5-(Tetrahydro-2H-thiopyran-4-yl)-1H-indazole
- 5-(Tetrahydro-Thiopyran-4-Yl)-1H-Indazole
- 1H-Indazole, 5-(tetrahydro-2H-thiopyran-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
