CAS 885272-62-8
:4-(1H-Indazol-5-yl)-1-methyl-4-piperidinol
Description:
4-(1H-Indazol-5-yl)-1-methyl-4-piperidinol, with the CAS number 885272-62-8, is a chemical compound characterized by its unique structural features, which include an indazole moiety and a piperidinol group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents. The presence of the indazole ring suggests potential biological activity, as indazole derivatives are often explored for their pharmacological properties. The piperidinol portion may contribute to its ability to interact with biological targets, possibly influencing its pharmacokinetics and pharmacodynamics. Additionally, the compound may exhibit basic properties due to the piperidine nitrogen, which can participate in hydrogen bonding. Its molecular structure allows for various functional group interactions, making it a candidate for further research in medicinal chemistry and drug development. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other chemical entities.
Formula:C13H17N3O
InChI:InChI=1S/C13H17N3O/c1-16-6-4-13(17,5-7-16)11-2-3-12-10(8-11)9-14-15-12/h2-3,8-9,17H,4-7H2,1H3,(H,14,15)
InChI key:InChIKey=HOZYPTAPNAJOST-UHFFFAOYSA-N
SMILES:OC1(C=2C=C3C(=CC2)NN=C3)CCN(C)CC1
Synonyms:- 4-(1H-Indazol-5-yl)-1-methyl-4-piperidinol
- 4-(1H-INDAZOL-5-YL)-1-METHYL-PIPERIDIN-4-OL
- 4-Piperidinol, 4-(1H-indazol-5-yl)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
