CAS 885272-67-3
:2-(3-Bromophenyl)-4-oxazolemethanol
Description:
2-(3-Bromophenyl)-4-oxazolemethanol is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of the 3-bromophenyl group indicates that there is a bromine atom attached to a phenyl ring at the meta position, contributing to the compound's unique reactivity and potential biological activity. The hydroxymethyl group (-CH2OH) at the 4-position of the oxazole ring enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas where halogenated compounds are known to exhibit enhanced biological activity. Additionally, the presence of both aromatic and heterocyclic components may contribute to its stability and reactivity in various chemical environments. As with many such compounds, further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C10H8BrNO2
InChI:InChI=1S/C10H8BrNO2/c11-8-3-1-2-7(4-8)10-12-9(5-13)6-14-10/h1-4,6,13H,5H2
InChI key:InChIKey=UYBRRDMUOTVNJV-UHFFFAOYSA-N
SMILES:C(O)C=1N=C(OC1)C2=CC(Br)=CC=C2
Synonyms:- 2-(3-Bromophenyl)-4-oxazolemethanol
- [2-(3-Bromo-Phenyl)-Oxazol-4-Yl]-Methanol
- 4-Oxazolemethanol, 2-(3-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
