CAS 885272-70-8
:5-(Tetrahydro-2H-pyran-4-yl)-1H-indazole
Description:
5-(Tetrahydro-2H-pyran-4-yl)-1H-indazole is a chemical compound characterized by its unique structure, which includes an indazole core fused with a tetrahydro-2H-pyran moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The indazole ring contributes to its aromatic character, while the tetrahydro-2H-pyran portion may influence its stereochemistry and overall molecular interactions. Such compounds are often of interest in medicinal chemistry due to their potential biological activities, including anti-inflammatory or neuroprotective effects. The presence of both heterocyclic and cyclic structures in its framework may also enhance its pharmacokinetic properties. As with many organic compounds, the specific characteristics, including melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which the compound is studied. Overall, 5-(Tetrahydro-2H-pyran-4-yl)-1H-indazole represents a class of compounds that can be explored for various applications in drug development and chemical research.
Formula:C12H14N2O
InChI:InChI=1S/C12H14N2O/c1-2-12-11(8-13-14-12)7-10(1)9-3-5-15-6-4-9/h1-2,7-9H,3-6H2,(H,13,14)
InChI key:InChIKey=VGDVEZOLXMDDTC-UHFFFAOYSA-N
SMILES:C=1(C=C2C(=CC1)NN=C2)C3CCOCC3
Synonyms:- 5-(Tetrahydro-2H-pyran-4-yl)-1H-indazole
- 1H-Indazole, 5-(tetrahydro-2H-pyran-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
