
CAS 885272-72-0
:5-(1,2,3,6-Tetrahydro-1-methyl-4-pyridinyl)-1H-indazole
Description:
5-(1,2,3,6-Tetrahydro-1-methyl-4-pyridinyl)-1H-indazole, identified by its CAS number 885272-72-0, is a chemical compound that features a complex structure comprising an indazole core and a tetrahydropyridine moiety. This compound is characterized by its potential biological activity, particularly in the context of pharmacological research. The presence of the tetrahydropyridine ring contributes to its ability to interact with various biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may exhibit properties such as lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, the presence of nitrogen atoms in both the indazole and pyridine rings may impart basicity, affecting its solubility and reactivity. Overall, 5-(1,2,3,6-Tetrahydro-1-methyl-4-pyridinyl)-1H-indazole represents a class of compounds that could be explored for therapeutic applications, although specific biological activities and mechanisms would require further investigation.
Formula:C13H15N3
InChI:InChI=1S/C13H15N3/c1-16-6-4-10(5-7-16)11-2-3-13-12(8-11)9-14-15-13/h2-4,8-9H,5-7H2,1H3,(H,14,15)
InChI key:InChIKey=XMNMKECUETVISF-UHFFFAOYSA-N
SMILES:CN1CCC(C=2C=C3C(=CC2)NN=C3)=CC1
Synonyms:- 5-(1,2,3,6-Tetrahydro-1-methyl-4-pyridinyl)-1H-indazole
- 1H-Indazole, 5-(1,2,3,6-tetrahydro-1-methyl-4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.