CymitQuimica logo

CAS 885272-79-7

:

2-(4-Bromophenyl)-4,5,6,7-tetrahydrooxazolo[5,4-c]pyridine

Description:
2-(4-Bromophenyl)-4,5,6,7-tetrahydrooxazolo[5,4-c]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both an oxazolo and a pyridine moiety. The presence of the bromophenyl group enhances its chemical reactivity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the fields of neuropharmacology and oncology, due to the presence of nitrogen-containing rings that can participate in various chemical reactions. The compound's unique arrangement of atoms contributes to its specific physical and chemical properties, including melting point, boiling point, and spectral characteristics, which can be determined through various analytical techniques. Overall, 2-(4-Bromophenyl)-4,5,6,7-tetrahydrooxazolo[5,4-c]pyridine represents a significant class of compounds with potential therapeutic implications.
Formula:C12H11BrN2O
InChI:InChI=1S/C12H11BrN2O/c13-9-3-1-8(2-4-9)12-15-10-5-6-14-7-11(10)16-12/h1-4,14H,5-7H2
InChI key:InChIKey=YRWMNCRLLVQVLS-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C2=NC3=C(O2)CNCC3)C=C1
Synonyms:
  • 2-(4-Bromophenyl)-4,5,6,7-tetrahydrooxazolo[5,4-c]pyridine
  • Oxazolo[5,4-c]pyridine, 2-(4-bromophenyl)-4,5,6,7-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.