CymitQuimica logo

CAS 885272-81-1

:

2-(3-Fluorophenyl)-4-oxazolemethanol

Description:
2-(3-Fluorophenyl)-4-oxazolemethanol, identified by its CAS number 885272-81-1, is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of a fluorophenyl group indicates that there is a fluorine atom attached to a phenyl ring at the meta position, which can influence the compound's electronic properties and reactivity. The hydroxymethyl group (-CH2OH) contributes to its potential as a versatile intermediate in organic synthesis, possibly enhancing solubility and reactivity in various chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure. As with many organic compounds, safety data and handling precautions should be considered, especially regarding its potential toxicity and environmental impact.
Formula:C10H8FNO2
InChI:InChI=1S/C10H8FNO2/c11-8-3-1-2-7(4-8)10-12-9(5-13)6-14-10/h1-4,6,13H,5H2
InChI key:InChIKey=RGQZKVPUGQEWCV-UHFFFAOYSA-N
SMILES:C(O)C=1N=C(OC1)C2=CC(F)=CC=C2
Synonyms:
  • 2-(3-Fluorophenyl)-4-oxazolemethanol
  • [2-(3-Fluoro-Phenyl)-Oxazol-4-Yl]-Methanol
  • 4-Oxazolemethanol, 2-(3-fluorophenyl)-
  • [2-(3-Fluorophenyl)-1,3-oxazol-4-yl]methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.