CAS 885272-82-2
:6-Methyl-2-phenylimidazo[1,2-a]pyridine-3-ethanamine
Description:
6-Methyl-2-phenylimidazo[1,2-a]pyridine-3-ethanamine is a chemical compound characterized by its complex heterocyclic structure, which includes an imidazo[1,2-a]pyridine core. This compound features a methyl group at the 6-position and a phenyl group at the 2-position, contributing to its unique chemical properties. The presence of an ethanamine side chain at the 3-position enhances its potential for biological activity. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, possibly influencing pathways related to neurotransmission or other physiological processes. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which may affect its application in research or therapeutic contexts. As with many heterocyclic compounds, understanding its synthesis, reactivity, and biological implications is crucial for its utilization in various scientific fields.
Formula:C16H17N3
InChI:InChI=1S/C16H17N3/c1-12-7-8-15-18-16(13-5-3-2-4-6-13)14(9-10-17)19(15)11-12/h2-8,11H,9-10,17H2,1H3
InChI key:InChIKey=OEARNSZQPKSOHM-UHFFFAOYSA-N
SMILES:C(CN)C1=C(N=C2N1C=C(C)C=C2)C3=CC=CC=C3
Synonyms:- 2-(6-Methyl-2-Phenyl-Imidazo[1,2-A]Pyridin-3-Yl)-Ethylamine
- 6-Methyl-2-phenylimidazo[1,2-a]pyridine-3-ethanamine
- Imidazo[1,2-a]pyridine-3-ethanamine, 6-methyl-2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.