CymitQuimica logo

CAS 885272-83-3

:

2-(3-Chlorophenyl)-4-oxazolemethanol

Description:
2-(3-Chlorophenyl)-4-oxazolemethanol is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of the 3-chlorophenyl group indicates that there is a chlorine atom attached to a phenyl ring at the meta position, contributing to the compound's unique reactivity and potential biological activity. The hydroxymethyl group (-CH2OH) at the 4-position of the oxazole ring suggests that this compound may exhibit properties typical of alcohols, such as hydrogen bonding capabilities. This compound may be of interest in medicinal chemistry due to its structural features, which could influence its pharmacological properties. Additionally, the chlorine substituent can enhance lipophilicity and affect the compound's interaction with biological targets. As with many heterocyclic compounds, the specific characteristics, including solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other functional groups. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C10H8ClNO2
InChI:InChI=1S/C10H8ClNO2/c11-8-3-1-2-7(4-8)10-12-9(5-13)6-14-10/h1-4,6,13H,5H2
InChI key:InChIKey=FIAOFEVLHBDYDQ-UHFFFAOYSA-N
SMILES:C(O)C=1N=C(OC1)C2=CC(Cl)=CC=C2
Synonyms:
  • 2-(3-Chlorophenyl)-4-oxazolemethanol
  • [2-(3-Chloro-Phenyl)-Oxazol-4-Yl]-Methanol
  • [2-(3-Chlorophenyl)-1,3-oxazol-4-yl]methanol
  • 4-Oxazolemethanol, 2-(3-chlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.