CAS 885272-84-4
:2-Phenylimidazo[1,2-a]pyridine-3-acetonitrile
Description:
2-Phenylimidazo[1,2-a]pyridine-3-acetonitrile is a heterocyclic organic compound characterized by its imidazo and pyridine rings, which contribute to its aromatic properties and potential biological activity. The structure features a phenyl group attached to the imidazo ring, enhancing its lipophilicity and possibly influencing its interaction with biological targets. The acetonitrile functional group introduces a nitrile moiety, which can participate in various chemical reactions and may affect the compound's reactivity and solubility. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-cancer and anti-inflammatory activities. Its molecular structure allows for various synthetic modifications, making it a versatile scaffold in drug development. Additionally, the presence of multiple functional groups suggests that it may engage in hydrogen bonding and other intermolecular interactions, which can be crucial for its biological efficacy. Overall, 2-Phenylimidazo[1,2-a]pyridine-3-acetonitrile represents a significant compound for research in both organic synthesis and medicinal applications.
Formula:C15H11N3
InChI:InChI=1S/C15H11N3/c16-10-9-13-15(12-6-2-1-3-7-12)17-14-8-4-5-11-18(13)14/h1-8,11H,9H2
InChI key:InChIKey=QWZCCRGBFMJYDB-UHFFFAOYSA-N
SMILES:C(C#N)C1=C(N=C2N1C=CC=C2)C3=CC=CC=C3
Synonyms:- 2-Phenyl-Imidazo[1,2-A]Pyridine-3-Acetonitrile
- 2-Phenylimidazo[1,2-a]pyridine-3-acetonitrile
- 2-[2-Phenylimidazo[1,2-a]pyridin-3-yl]acetonitrile
- Imidazo[1,2-a]pyridine-3-acetonitrile, 2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
