CAS 885272-86-6
:5-(4-Fluorophenyl)-1H-indazole
Description:
5-(4-Fluorophenyl)-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a 4-fluorophenyl group at the 5-position of the indazole contributes to its unique properties, including potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests that it could engage in various interactions, such as hydrogen bonding and π-π stacking, which may influence its reactivity and interactions with biological targets. The fluorine atom in the phenyl group can enhance lipophilicity and metabolic stability, making it of interest in medicinal chemistry. Additionally, compounds like this are often studied for their potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H9FN2
InChI:InChI=1S/C13H9FN2/c14-12-4-1-9(2-5-12)10-3-6-13-11(7-10)8-15-16-13/h1-8H,(H,15,16)
InChI key:InChIKey=HKAWBFIKAUENTE-UHFFFAOYSA-N
SMILES:FC1=CC=C(C=2C=C3C(=CC2)NN=C3)C=C1
Synonyms:- 5-(4-Fluoro-Phenyl)-1H-Indazole
- 5-(4-Fluorophenyl)-1H-indazole
- 1H-Indazole, 5-(4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-(4-Fluorophenyl)-1H-indazole
CAS:<p>5-(4-Fluorophenyl)-1H-indazole</p>Molecular weight:212.22236g/mol


