CymitQuimica logo

CAS 885272-88-8

:

5-(5-Methyl-2-thienyl)-1H-indazole

Description:
5-(5-Methyl-2-thienyl)-1H-indazole, identified by its CAS number 885272-88-8, is an organic compound that features a fused indazole structure with a thienyl substituent. This compound typically exhibits characteristics common to heterocyclic compounds, including potential biological activity due to its unique molecular structure. The presence of the thienyl group, which contains sulfur, may impart specific electronic properties and influence its reactivity and solubility. The indazole moiety contributes to the compound's aromaticity, which can enhance stability and affect interactions with biological targets. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Additionally, the presence of the methyl group on the thienyl ring can affect the steric and electronic properties, potentially influencing the compound's behavior in various chemical environments. Overall, 5-(5-Methyl-2-thienyl)-1H-indazole represents a class of compounds with diverse applications in medicinal chemistry and materials science.
Formula:C12H10N2S
InChI:InChI=1S/C12H10N2S/c1-8-2-5-12(15-8)9-3-4-11-10(6-9)7-13-14-11/h2-7H,1H3,(H,13,14)
InChI key:InChIKey=CBKCXAJFGJLDKP-UHFFFAOYSA-N
SMILES:CC=1SC(C=2C=C3C(=CC2)NN=C3)=CC1
Synonyms:
  • 5-(5-Methyl-2-thienyl)-1H-indazole
  • 5-(5-Methyl-Thiophen-2-Yl)-1H-Indazole
  • 1H-Indazole, 5-(5-methyl-2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.