CymitQuimica logo

CAS 885273-02-9

:

1-(4-Cyanophenyl)-1H-indole-5-carbonitrile

Description:
1-(4-Cyanophenyl)-1H-indole-5-carbonitrile, with the CAS number 885273-02-9, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a cyanophenyl group at the 1-position and a carbonitrile group at the 5-position of the indole moiety, contributing to its potential as a bioactive molecule. The presence of the cyano groups enhances its reactivity and may influence its solubility and polarity. Typically, compounds like this are of interest in medicinal chemistry due to their potential pharmacological properties, including anti-cancer and anti-inflammatory activities. The compound's molecular structure suggests that it may engage in various interactions, such as hydrogen bonding and π-π stacking, which are crucial for biological activity. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest for further research in drug development and material science.
Formula:C16H9N3
InChI:InChI=1S/C16H9N3/c17-10-12-1-4-15(5-2-12)19-8-7-14-9-13(11-18)3-6-16(14)19/h1-9H
InChI key:InChIKey=PFNGEQDWIWTIAM-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C2C(N(C=C2)C3=CC=C(C#N)C=C3)=CC1
Synonyms:
  • 1-(4-Cyanophenyl)-1H-indole-5-carbonitrile
  • 1H-Indole-5-carbonitrile, 1-(4-cyanophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.