CAS 885273-08-5
:6-Bromo-1,2,4,9-tetrahydro-3H-carbazol-3-one
Description:
6-Bromo-1,2,4,9-tetrahydro-3H-carbazol-3-one is a chemical compound characterized by its unique structure, which includes a carbazole core with a bromine substituent and a ketone functional group. This compound typically exhibits a molecular formula that reflects its complex ring structure, contributing to its potential biological activity. The presence of the bromine atom can influence its reactivity and solubility, often enhancing its lipophilicity. As a tetrahydro derivative, it possesses a saturated ring system, which may affect its conformational flexibility and interactions with biological targets. Compounds of this nature are often studied for their potential pharmacological properties, including anti-cancer and neuroprotective effects. Additionally, the compound's synthesis and characterization may involve various organic chemistry techniques, including NMR and mass spectrometry, to confirm its structure and purity. Overall, 6-Bromo-1,2,4,9-tetrahydro-3H-carbazol-3-one represents a class of compounds that are of interest in medicinal chemistry and drug development.
Formula:C12H10BrNO
InChI:InChI=1S/C12H10BrNO/c13-7-1-3-11-9(5-7)10-6-8(15)2-4-12(10)14-11/h1,3,5,14H,2,4,6H2
InChI key:InChIKey=DHANUQYJKHUHNL-UHFFFAOYSA-N
SMILES:BrC=1C=C2C3=C(NC2=CC1)CCC(=O)C3
Synonyms:- 6-Bromo-1,2,4,9-Tetrahydro-Carbazol-3-One
- 6-Bromo-1,2,4,9-tetrahydro-3H-carbazol-3-one
- 3H-Carbazol-3-one, 6-bromo-1,2,4,9-tetrahydro-
- 6-broMo-4,9-dihydro-1H-carbazol-3(2H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
