CAS 885273-10-9
:6-(3,6-Dihydro-2H-thiopyran-4-yl)-1H-indole
Description:
6-(3,6-Dihydro-2H-thiopyran-4-yl)-1H-indole, identified by its CAS number 885273-10-9, is a chemical compound that features a fused indole and thiopyran structure. This compound typically exhibits properties associated with both indole and thiopyran moieties, which may include biological activity and potential pharmacological applications. The indole portion contributes to its aromatic character and may influence its interactions with biological targets, while the thiopyran ring can impart unique reactivity and stability characteristics. The presence of the dihydrothiopyran ring suggests that the compound may have a degree of saturation, which can affect its solubility and reactivity. Overall, this compound may be of interest in medicinal chemistry for its potential therapeutic effects, although specific biological activities and applications would require further investigation through experimental studies. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the sample.
Formula:C13H13NS
InChI:InChI=1S/C13H13NS/c1-2-12(10-4-7-15-8-5-10)9-13-11(1)3-6-14-13/h1-4,6,9,14H,5,7-8H2
InChI key:InChIKey=MWFPOUGZQLXDKL-UHFFFAOYSA-N
SMILES:C=1(C=C2C(=CC1)C=CN2)C=3CCSCC3
Synonyms:- 6-(3,6-Dihydro-2H-thiopyran-4-yl)-1H-indole
- 1H-Indole, 6-(3,6-dihydro-2H-thiopyran-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
