CAS 885273-15-4
:2-(3-Chlorophenyl)-4-oxazolecarboxaldehyde
Description:
2-(3-Chlorophenyl)-4-oxazolecarboxaldehyde is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a 3-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring at the meta position, which can influence the compound's reactivity and biological activity. The aldehyde functional group (-CHO) attached to the oxazole ring contributes to its chemical properties, making it a potential candidate for various synthetic applications, including in pharmaceuticals and agrochemicals. This compound may exhibit interesting biological activities due to the combination of the oxazole and chlorophenyl moieties, which can affect its interaction with biological targets. Additionally, its solubility, stability, and reactivity can vary based on the specific conditions under which it is used. Overall, 2-(3-Chlorophenyl)-4-oxazolecarboxaldehyde represents a versatile structure in organic chemistry with potential applications in medicinal chemistry and material science.
Formula:C10H6ClNO2
InChI:InChI=1S/C10H6ClNO2/c11-8-3-1-2-7(4-8)10-12-9(5-13)6-14-10/h1-6H
InChI key:InChIKey=BBFSHCIZLJMBBV-UHFFFAOYSA-N
SMILES:C(=O)C=1N=C(OC1)C2=CC(Cl)=CC=C2
Synonyms:- 2-(3-Chloro-Phenyl)-Oxazole-4-Carbaldehyde
- 2-(3-Chlorophenyl)-4-oxazolecarboxaldehyde
- 4-Oxazolecarboxaldehyde, 2-(3-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
