CAS 885273-17-6
:4-Oxazolemethanamine,2-(3-methoxyphenyl)-
Description:
4-Oxazolemethanamine, 2-(3-methoxyphenyl)- is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features an amine functional group, contributing to its potential reactivity and interactions in various chemical environments. The presence of the 3-methoxyphenyl group indicates that it has a methoxy substituent on a phenyl ring, which can influence its solubility, polarity, and biological activity. Compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential applications in areas such as agrochemicals or pharmaceuticals, where modifications to the oxazole and phenyl moieties can lead to diverse biological activities. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the compound's purity and the conditions under which they are measured.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-14-10-4-2-3-8(5-10)11-13-9(6-12)7-15-11/h2-5,7H,6,12H2,1H3
InChI key:InChIKey=VTOCLFFVCLIXPZ-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(OC1)C2=CC(OC)=CC=C2
Synonyms:- 2-(3-Methoxy-Phenyl)-Oxazol-4-Yl-Methylamine
- 2-(3-Methoxyphenyl)-4-oxazolemethanamine
- C-[2-(3-Methoxy-Phenyl)-Oxazol-4-Yl]-Methylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
