CAS 885273-19-8
:Ethyl 2-(3-methylphenyl)-4-oxazolecarboxylate
Description:
Ethyl 2-(3-methylphenyl)-4-oxazolecarboxylate, identified by its CAS number 885273-19-8, is an organic compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of the 3-methylphenyl group indicates that it has a substituted aromatic ring, which can influence its chemical behavior, including its stability and interaction with other molecules. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The oxazole moiety is known for its role in various chemical reactions and applications, including as intermediates in organic synthesis. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular structure and functional groups. Overall, Ethyl 2-(3-methylphenyl)-4-oxazolecarboxylate represents a class of compounds with potential applications in medicinal chemistry and materials science.
Formula:C13H13NO3
InChI:InChI=1S/C13H13NO3/c1-3-16-13(15)11-8-17-12(14-11)10-6-4-5-9(2)7-10/h4-8H,3H2,1-2H3
InChI key:InChIKey=UOLQCERAFZIHJD-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N=C(OC1)C2=CC(C)=CC=C2
Synonyms:- 2-M-Tolyl-Oxazole-4-Carboxylic Acid Ethyl Ester
- 4-Oxazolecarboxylic acid, 2-(3-methylphenyl)-, ethyl ester
- Ethyl 2-(3-methylphenyl)-4-oxazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
