CymitQuimica logo

CAS 885273-21-2

:

2-(3-Methylphenyl)-4-oxazolemethanamine

Description:
2-(3-Methylphenyl)-4-oxazolemethanamine, identified by its CAS number 885273-21-2, is a chemical compound that features an oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound is characterized by the presence of a 3-methylphenyl group, indicating a methyl substituent on the phenyl ring, which can influence its physical and chemical properties, such as solubility and reactivity. The methanamine functional group suggests that it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions. The oxazole moiety may also contribute to biological activity, making this compound of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's unique structure positions it as a potential candidate for further research in various applications, including pharmaceuticals and materials science.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-8-3-2-4-9(5-8)11-13-10(6-12)7-14-11/h2-5,7H,6,12H2,1H3
InChI key:InChIKey=TXUMBIHQJMDUPY-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(OC1)C2=CC(C)=CC=C2
Synonyms:
  • 2-(3-Methylphenyl)-4-oxazolemethanamine
  • 4-Oxazolemethanamine, 2-(3-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.