CAS 885273-24-5
:5-(3,6-Dihydro-2H-pyran-4-yl)-1H-indole
Description:
5-(3,6-Dihydro-2H-pyran-4-yl)-1H-indole, with the CAS number 885273-24-5, is a chemical compound that features a fused indole and dihydropyran structure. This compound typically exhibits characteristics common to indole derivatives, such as potential biological activity, including antimicrobial and anticancer properties. The presence of the dihydropyran moiety may contribute to its reactivity and solubility in organic solvents. The compound is likely to be a solid at room temperature, with a specific melting point that can vary based on purity and crystallization conditions. Its molecular structure suggests it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic additions, making it of interest in synthetic organic chemistry. Additionally, the compound's unique structure may allow for interactions with biological targets, making it a candidate for further pharmacological studies. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c1-2-13-12(3-6-14-13)9-11(1)10-4-7-15-8-5-10/h1-4,6,9,14H,5,7-8H2
InChI key:InChIKey=LEXJZVFPCNBDOR-UHFFFAOYSA-N
SMILES:C=1(C=C2C(=CC1)NC=C2)C=3CCOCC3
Synonyms:- 5-(3,6-Dihydro-2H-Pyran-4-Yl)-1H-Indole
- 1H-Indole, 5-(3,6-dihydro-2H-pyran-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
