CAS 885273-27-8
:5-(Tetrahydro-2H-pyran-4-yl)-1H-indole
Description:
5-(Tetrahydro-2H-pyran-4-yl)-1H-indole is an organic compound characterized by its indole core, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of the tetrahydro-2H-pyran moiety introduces a cyclic ether functionality, contributing to the compound's unique chemical properties. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic indole structure, while the tetrahydropyran ring may enhance its stability and reactivity. It may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, owing to the presence of both the indole and ether functionalities. Additionally, compounds of this nature are often studied for their potential biological activities, including antimicrobial and anticancer properties, making them of interest in medicinal chemistry. The specific interactions and reactivity can vary based on the substituents and the overall molecular conformation, which can influence its pharmacological profile.
Formula:C13H15NO
InChI:InChI=1S/C13H15NO/c1-2-13-12(3-6-14-13)9-11(1)10-4-7-15-8-5-10/h1-3,6,9-10,14H,4-5,7-8H2
InChI key:InChIKey=HNIURSQGQFJLTJ-UHFFFAOYSA-N
SMILES:C=1(C=C2C(=CC1)NC=C2)C3CCOCC3
Synonyms:- 5-(Tetrahydro-2H-pyran-4-yl)-1H-indole
- 5-(Tetrahydro-Pyran-4-Yl)-1H-Indole
- 1H-Indole, 5-(tetrahydro-2H-pyran-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
