CAS 885273-28-9
:3-(4-Chlorophenyl)-1,2-benzisoxazol-6-ol
Description:
3-(4-Chlorophenyl)-1,2-benzisoxazol-6-ol, identified by its CAS number 885273-28-9, is a chemical compound that features a benzisoxazole core substituted with a 4-chlorophenyl group and a hydroxyl group. This compound is characterized by its aromatic structure, which contributes to its stability and potential reactivity. The presence of the hydroxyl group (–OH) indicates that it may exhibit phenolic properties, potentially influencing its solubility and interaction with other chemical species. The 4-chlorophenyl substituent can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. Additionally, the chlorinated aromatic ring can impart unique electronic properties, which may influence the compound's reactivity and interactions in various chemical environments. Overall, this compound's structural features suggest potential applications in pharmaceuticals or as a research tool in studying biological systems.
Formula:C13H8ClNO2
InChI:InChI=1S/C13H8ClNO2/c14-9-3-1-8(2-4-9)13-11-6-5-10(16)7-12(11)17-15-13/h1-7,16H
InChI key:InChIKey=XNRZCAJQNMILBF-UHFFFAOYSA-N
SMILES:OC=1C=C2C(C(=NO2)C3=CC=C(Cl)C=C3)=CC1
Synonyms:- 3-(4-Chlorophenyl)-1,2-benzisoxazol-6-ol
- 3-(4-Chlorophenyl)benzo[d]isoxazol-6-ol
- 1,2-Benzisoxazol-6-ol, 3-(4-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
