CAS 885273-32-5
:2-(3,4-Dimethylphenyl)-4-oxazolecarboxaldehyde
Description:
2-(3,4-Dimethylphenyl)-4-oxazolecarboxaldehyde is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a carboxaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of the 3,4-dimethylphenyl substituent contributes to its hydrophobic characteristics and may influence its solubility in various solvents. The compound is likely to exhibit moderate stability under standard conditions, but the aldehyde group can be prone to oxidation and condensation reactions. Its unique structure may allow for specific interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods, providing insights into its behavior in different environments. Overall, 2-(3,4-Dimethylphenyl)-4-oxazolecarboxaldehyde is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C12H11NO2
InChI:InChI=1S/C12H11NO2/c1-8-3-4-10(5-9(8)2)12-13-11(6-14)7-15-12/h3-7H,1-2H3
InChI key:InChIKey=WHCYEAQWWRLBRQ-UHFFFAOYSA-N
SMILES:C(=O)C=1N=C(OC1)C2=CC(C)=C(C)C=C2
Synonyms:- 2-(3,4-Dimethyl-Phenyl)-Oxazole-4-Carbaldehyde
- 2-(3,4-Dimethylphenyl)-4-oxazolecarboxaldehyde
- 4-Oxazolecarboxaldehyde, 2-(3,4-dimethylphenyl)-
- 2-(3,4-dimethylphenyl)-1,3-oxazole-4-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
