CymitQuimica logo

CAS 885273-34-7

:

4,5,6,7-Tetrahydro-2-(4-methylphenyl)oxazolo[5,4-c]pyridine

Description:
4,5,6,7-Tetrahydro-2-(4-methylphenyl)oxazolo[5,4-c]pyridine is a heterocyclic compound characterized by its complex bicyclic structure, which includes both a pyridine and an oxazole moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its stability and potential biological activity. The presence of the 4-methylphenyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. The compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its CAS number, 885273-34-7, allows for precise identification in chemical databases and literature. As with many heterocycles, it may exhibit diverse reactivity patterns, making it a candidate for various synthetic applications. Overall, the characteristics of this compound suggest potential utility in pharmaceutical research, although further studies would be necessary to elucidate its specific biological effects and mechanisms of action.
Formula:C13H14N2O
InChI:InChI=1S/C13H14N2O/c1-9-2-4-10(5-3-9)13-15-11-6-7-14-8-12(11)16-13/h2-5,14H,6-8H2,1H3
InChI key:InChIKey=BHEUIVVWMMBOIL-UHFFFAOYSA-N
SMILES:CC1=CC=C(C2=NC3=C(O2)CNCC3)C=C1
Synonyms:
  • Oxazolo[5,4-c]pyridine, 4,5,6,7-tetrahydro-2-(4-methylphenyl)-
  • 4,5,6,7-Tetrahydro-2-(4-methylphenyl)oxazolo[5,4-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.