CAS 885273-39-2
:5-(Tetrahydro-2H-thiopyran-4-yl)-1H-indole
Description:
5-(Tetrahydro-2H-thiopyran-4-yl)-1H-indole, with the CAS number 885273-39-2, is a chemical compound that features a fused indole structure combined with a tetrahydrothiopyran moiety. This compound is characterized by its heterocyclic framework, which includes both nitrogen and sulfur atoms, contributing to its unique chemical properties. The indole portion is known for its aromaticity and biological activity, often found in various natural products and pharmaceuticals. The tetrahydrothiopyran ring adds a saturated cyclic structure that can influence the compound's solubility and reactivity. Such compounds may exhibit interesting pharmacological activities, making them of interest in medicinal chemistry. Additionally, the presence of the sulfur atom can enhance the compound's ability to participate in various chemical reactions, such as nucleophilic substitutions or redox processes. Overall, this compound's structural features suggest potential applications in drug development and materials science, although specific biological activities and applications would require further investigation.
Formula:C13H15NS
InChI:InChI=1S/C13H15NS/c1-2-13-12(3-6-14-13)9-11(1)10-4-7-15-8-5-10/h1-3,6,9-10,14H,4-5,7-8H2
InChI key:InChIKey=KXRMDCMGCHDURS-UHFFFAOYSA-N
SMILES:C=1(C=C2C(=CC1)NC=C2)C3CCSCC3
Synonyms:- 5-(Tetrahydro-2H-thiopyran-4-yl)-1H-indole
- 1H-Indole, 5-(tetrahydro-2H-thiopyran-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
