CAS 885273-41-6

6-Benzo[b]thien-2-yl-1H-indole

Description:

6-Benzo[b]thien-2-yl-1H-indole is a chemical compound characterized by its unique structure, which combines an indole moiety with a benzo[b]thienyl group. This compound features a fused bicyclic system that contributes to its aromatic properties and potential biological activity. The presence of sulfur in the thienyl ring can influence its reactivity and solubility, making it of interest in various chemical and pharmaceutical applications. Typically, compounds like this may exhibit properties such as fluorescence or photostability, which can be advantageous in materials science and drug development. Additionally, the structural features may allow for interactions with biological targets, suggesting potential roles in medicinal chemistry. The compound's specific characteristics, including its melting point, solubility, and spectral properties, would be determined through experimental methods. Overall, 6-Benzo[b]thien-2-yl-1H-indole represents a class of heterocyclic compounds that are valuable in research and development within organic chemistry and related fields.

Formula: C₁₆H₁₁NS

InChI: InChI=1S/C16H11NS/c1-2-4-15-12(3-1)10-16(18-15)13-6-5-11-7-8-17-14(11)9-13/h1-10,17H

InChI key: InChIKey=RAXZRLLHTSSBKZ-UHFFFAOYSA-N

SMILES: C1(=CC=2C(S1)=CC=CC2)C=3C=C4C(=CC3)C=CN4

Synonyms:

• 6-(Benzothiophen-2-Yl)-1H-Indole
• 6-Benzo[b]thien-2-yl-1H-indole
• 1H-Indole, 6-benzo[b]thien-2-yl-

6-(Benzo[b]thiophen-2-yl)-1H-indole

CAS: 885273-41-6

Formula: C₁₆H₁₁NS

Molecular weight: 249.3302

Ref: IN-DA0046X3