CAS 885273-44-9

2-[4-(Phenylmethoxy)phenyl]-4-oxazolemethanamine

Description:

2-[4-(Phenylmethoxy)phenyl]-4-oxazolemethanamine, with the CAS number 885273-44-9, is a chemical compound characterized by its unique structural features, including an oxazole ring and a phenylmethoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, stability, and reactivity. The presence of the oxazole moiety suggests potential biological activity, as oxazoles are often found in various pharmaceuticals and bioactive molecules. Additionally, the phenylmethoxy group can enhance lipophilicity, potentially affecting the compound's interaction with biological membranes. The compound may also display specific optical properties due to its aromatic components. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods such as NMR and mass spectrometry for structural confirmation. Overall, this compound's unique structure may lend itself to applications in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₁₇H₁₆N₂O₂

InChI: InChI=1S/C17H16N2O2/c18-10-15-12-21-17(19-15)14-6-8-16(9-7-14)20-11-13-4-2-1-3-5-13/h1-9,12H,10-11,18H2

InChI key: InChIKey=NJPXTQJYUAGDHA-UHFFFAOYSA-N

SMILES: C(N)C=1N=C(OC1)C2=CC=C(OCC3=CC=CC=C3)C=C2

Synonyms:

• 2-(4-Benzyloxy-Phenyl)-Oxazol-4-Yl-Methylamine
• 2-[4-(Phenylmethoxy)phenyl]-4-oxazolemethanamine
• C-[2-(4-Benzyloxy-Phenyl)-Oxazol-4-Yl]-Methylamine
• 4-Oxazolemethanamine, 2-[4-(phenylmethoxy)phenyl]-

(2-(4-(Benzyloxy)phenyl)oxazol-4-yl)methanamine

CAS: 885273-44-9

Formula: C₁₇H₁₆N₂O₂

Molecular weight: 280.3211

Ref: IN-DA0046X2